C22H24ClN3O5S — CID 2419259
(3R)-3-[4-(benzenesulfonyl)piperazin-1-yl]-1-(4-chloro-2-methoxy-5-methylphenyl)pyrrolidine-2,5-dione (PubChem CID 2419259) has the molecular formula C22H24ClN3O5S and a molecular weight of 477.97 g/mol. Its IUPAC name is (3R)-3-[4-(benzenesulfonyl)piperazin-1-yl]-1-(4-chloro-2-methoxy-5-methylphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-(benzenesulfonyl)piperazin-1-yl]-1-(4-chloro-2-methoxy-5-methylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2419259 |
| Molecular Formula | C22H24ClN3O5S |
| Molecular Weight | 477.97 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | (3R)-3-[4-(benzenesulfonyl)piperazin-1-yl]-1-(4-chloro-2-methoxy-5-methylphenyl)pyrrolidine-2,5-dione |
| SMILES | COc1cc(Cl)c(C)cc1N1C(=O)C[C@@H](N2CCN(S(=O)(=O)c3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C22H24ClN3O5S/c1-15-12-18(20(31-2)13-17(15)23)26-21(27)14-19(22(26)28)24-8-10-25(11-9-24)32(29,30)16-6-4-3-5-7-16/h3-7,12-13,19H,8-11,14H2,1-2H3/t19-/m1/s1 |
| InChIKey | ZKLIUHJGSYMZEA-LJQANCHMSA-N |
| XLogP | 2.30 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.97 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|