C22H24ClN3O4S — CID 2107813
(3R)-3-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-1-(2,4-dimethylphenyl)pyrrolidine-2,5-dione (PubChem CID 2107813) has the molecular formula C22H24ClN3O4S and a molecular weight of 461.97 g/mol. Its IUPAC name is (3R)-3-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-1-(2,4-dimethylphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-1-(2,4-dimethylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2107813 |
| Molecular Formula | C22H24ClN3O4S |
| Molecular Weight | 461.97 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | (3R)-3-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-1-(2,4-dimethylphenyl)pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)C[C@@H](N3CCN(S(=O)(=O)c4ccc(Cl)cc4)CC3)C2=O)c(C)c1 |
| InChI | InChI=1S/C22H24ClN3O4S/c1-15-3-8-19(16(2)13-15)26-21(27)14-20(22(26)28)24-9-11-25(12-10-24)31(29,30)18-6-4-17(23)5-7-18/h3-8,13,20H,9-12,14H2,1-2H3/t20-/m1/s1 |
| InChIKey | RRTHMVYUHQMDFV-HXUWFJFHSA-N |
| XLogP | 2.60 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.97 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|