C15H17Cl2N3O2 — CID 682977
(3S)-1-(2,4-dichlorophenyl)-3-(4-methylpiperazin-1-yl)pyrrolidine-2,5-dione (PubChem CID 682977) has the molecular formula C15H17Cl2N3O2 and a molecular weight of 342.23 g/mol. Its IUPAC name is (3S)-1-(2,4-dichlorophenyl)-3-(4-methylpiperazin-1-yl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(2,4-dichlorophenyl)-3-(4-methylpiperazin-1-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 682977 |
| Molecular Formula | C15H17Cl2N3O2 |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | (3S)-1-(2,4-dichlorophenyl)-3-(4-methylpiperazin-1-yl)pyrrolidine-2,5-dione |
| SMILES | CN1CCN([C@H]2CC(=O)N(c3ccc(Cl)cc3Cl)C2=O)CC1 |
| InChI | InChI=1S/C15H17Cl2N3O2/c1-18-4-6-19(7-5-18)13-9-14(21)20(15(13)22)12-3-2-10(16)8-11(12)17/h2-3,8,13H,4-7,9H2,1H3/t13-/m0/s1 |
| InChIKey | ZJMJEIFCGONJEY-ZDUSSCGKSA-N |
| XLogP | 1.87 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|