C15H17FN2O2 — CID 43840960
1-(2-fluoro-4-methylphenyl)-3-pyrrolidin-1-ylpyrrolidine-2,5-dione (PubChem CID 43840960) has the molecular formula C15H17FN2O2 and a molecular weight of 276.31 g/mol. Its IUPAC name is 1-(2-fluoro-4-methylphenyl)-3-pyrrolidin-1-ylpyrrolidine-2,5-dione.
| Compound Name | 1-(2-fluoro-4-methylphenyl)-3-pyrrolidin-1-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 43840960 |
| Molecular Formula | C15H17FN2O2 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 1-(2-fluoro-4-methylphenyl)-3-pyrrolidin-1-ylpyrrolidine-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)CC(N3CCCC3)C2=O)c(F)c1 |
| InChI | InChI=1S/C15H17FN2O2/c1-10-4-5-12(11(16)8-10)18-14(19)9-13(15(18)20)17-6-2-3-7-17/h4-5,8,13H,2-3,6-7,9H2,1H3 |
| InChIKey | JFUGLFGMVAGFNW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|