C20H26N2O4 — CID 124833227
ethyl (3R)-1-[(3S)-1-(2,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-3-carboxylate (PubChem CID 124833227) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is ethyl (3R)-1-[(3S)-1-(2,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[(3S)-1-(2,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 124833227 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | ethyl (3R)-1-[(3S)-1-(2,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN([C@H]2CC(=O)N(c3ccc(C)cc3C)C2=O)C1 |
| InChI | InChI=1S/C20H26N2O4/c1-4-26-20(25)15-6-5-9-21(12-15)17-11-18(23)22(19(17)24)16-8-7-13(2)10-14(16)3/h7-8,10,15,17H,4-6,9,11-12H2,1-3H3/t15-,17+/m1/s1 |
| InChIKey | GGORKDMWGUOYJH-WBVHZDCISA-N |
| XLogP | 2.21 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|