C19H24N2O4 — CID 27518629
ethyl (3R)-1-[(3R)-1-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-3-carboxylate (PubChem CID 27518629) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is ethyl (3R)-1-[(3R)-1-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[(3R)-1-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 27518629 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | ethyl (3R)-1-[(3R)-1-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN([C@@H]2CC(=O)N(c3ccccc3C)C2=O)C1 |
| InChI | InChI=1S/C19H24N2O4/c1-3-25-19(24)14-8-6-10-20(12-14)16-11-17(22)21(18(16)23)15-9-5-4-7-13(15)2/h4-5,7,9,14,16H,3,6,8,10-12H2,1-2H3/t14-,16-/m1/s1 |
| InChIKey | ZSBQCLDGBGNXFW-GDBMZVCRSA-N |
| XLogP | 1.90 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|