C21H21Cl2N3O2 — CID 93235132
(3R)-3-(4-benzylpiperazin-1-yl)-1-(2,4-dichlorophenyl)pyrrolidine-2,5-dione (PubChem CID 93235132) has the molecular formula C21H21Cl2N3O2 and a molecular weight of 418.32 g/mol. Its IUPAC name is (3R)-3-(4-benzylpiperazin-1-yl)-1-(2,4-dichlorophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(4-benzylpiperazin-1-yl)-1-(2,4-dichlorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 93235132 |
| Molecular Formula | C21H21Cl2N3O2 |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | (3R)-3-(4-benzylpiperazin-1-yl)-1-(2,4-dichlorophenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H](N2CCN(Cc3ccccc3)CC2)C(=O)N1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H21Cl2N3O2/c22-16-6-7-18(17(23)12-16)26-20(27)13-19(21(26)28)25-10-8-24(9-11-25)14-15-4-2-1-3-5-15/h1-7,12,19H,8-11,13-14H2/t19-/m1/s1 |
| InChIKey | BPFWNHXBXCTAQZ-LJQANCHMSA-N |
| XLogP | 3.44 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|