C17H18Cl2N2O4 — CID 29101420
(3R)-1-(2,4-dichlorophenyl)-3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyrrolidine-2,5-dione (PubChem CID 29101420) has the molecular formula C17H18Cl2N2O4 and a molecular weight of 385.25 g/mol. Its IUPAC name is (3R)-1-(2,4-dichlorophenyl)-3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(2,4-dichlorophenyl)-3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 29101420 |
| Molecular Formula | C17H18Cl2N2O4 |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | (3R)-1-(2,4-dichlorophenyl)-3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H](N2CCC3(CC2)OCCO3)C(=O)N1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H18Cl2N2O4/c18-11-1-2-13(12(19)9-11)21-15(22)10-14(16(21)23)20-5-3-17(4-6-20)24-7-8-25-17/h1-2,9,14H,3-8,10H2/t14-/m1/s1 |
| InChIKey | OZEBSXJEUFKKOB-CQSZACIVSA-N |
| XLogP | 2.46 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|