C21H21Cl2N3O4S — CID 2085480
(3R)-1-(3,4-dichlorophenyl)-3-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]pyrrolidine-2,5-dione (PubChem CID 2085480) has the molecular formula C21H21Cl2N3O4S and a molecular weight of 482.39 g/mol. Its IUPAC name is (3R)-1-(3,4-dichlorophenyl)-3-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(3,4-dichlorophenyl)-3-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2085480 |
| Molecular Formula | C21H21Cl2N3O4S |
| Molecular Weight | 482.39 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | (3R)-1-(3,4-dichlorophenyl)-3-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN([C@@H]3CC(=O)N(c4ccc(Cl)c(Cl)c4)C3=O)CC2)cc1 |
| InChI | InChI=1S/C21H21Cl2N3O4S/c1-14-2-5-16(6-3-14)31(29,30)25-10-8-24(9-11-25)19-13-20(27)26(21(19)28)15-4-7-17(22)18(23)12-15/h2-7,12,19H,8-11,13H2,1H3/t19-/m1/s1 |
| InChIKey | OKUBBIVHMKPYFV-LJQANCHMSA-N |
| XLogP | 2.94 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|