C21H21ClFN3O4S — CID 5166097
1-(3-chloro-4-fluorophenyl)-3-[4-(4-methylsulfonylphenyl)piperazin-1-yl]pyrrolidine-2,5-dione (PubChem CID 5166097) has the molecular formula C21H21ClFN3O4S and a molecular weight of 465.93 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[4-(4-methylsulfonylphenyl)piperazin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[4-(4-methylsulfonylphenyl)piperazin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 5166097 |
| Molecular Formula | C21H21ClFN3O4S |
| Molecular Weight | 465.93 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[4-(4-methylsulfonylphenyl)piperazin-1-yl]pyrrolidine-2,5-dione |
| SMILES | CS(=O)(=O)c1ccc(N2CCN(C3CC(=O)N(c4ccc(F)c(Cl)c4)C3=O)CC2)cc1 |
| InChI | InChI=1S/C21H21ClFN3O4S/c1-31(29,30)16-5-2-14(3-6-16)24-8-10-25(11-9-24)19-13-20(27)26(21(19)28)15-4-7-18(23)17(22)12-15/h2-7,12,19H,8-11,13H2,1H3 |
| InChIKey | MQRHPDQCTAVEGJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.93 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|