C20H18Cl2FN3O4S — CID 4966397
1-(3,4-dichlorophenyl)-3-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]pyrrolidine-2,5-dione (PubChem CID 4966397) has the molecular formula C20H18Cl2FN3O4S and a molecular weight of 486.35 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 4966397 |
| Molecular Formula | C20H18Cl2FN3O4S |
| Molecular Weight | 486.35 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(N2CCN(S(=O)(=O)c3ccccc3F)CC2)C(=O)N1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H18Cl2FN3O4S/c21-14-6-5-13(11-15(14)22)26-19(27)12-17(20(26)28)24-7-9-25(10-8-24)31(29,30)18-4-2-1-3-16(18)23/h1-6,11,17H,7-10,12H2 |
| InChIKey | APFPNXKLZXBVPX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|