C21H23ClN3O4S+ — CID 2108662
(3S)-1-(4-chlorophenyl)-3-[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]pyrrolidine-2,5-dione (PubChem CID 2108662) has the molecular formula C21H23ClN3O4S+ and a molecular weight of 448.95 g/mol. Its IUPAC name is (3S)-1-(4-chlorophenyl)-3-[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(4-chlorophenyl)-3-[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2108662 |
| Molecular Formula | C21H23ClN3O4S+ |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | (3S)-1-(4-chlorophenyl)-3-[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[NH+]([C@H]3CC(=O)N(c4ccc(Cl)cc4)C3=O)CC2)cc1 |
| InChI | InChI=1S/C21H22ClN3O4S/c1-15-2-8-18(9-3-15)30(28,29)24-12-10-23(11-13-24)19-14-20(26)25(21(19)27)17-6-4-16(22)5-7-17/h2-9,19H,10-14H2,1H3/p+1/t19-/m0/s1 |
| InChIKey | NJGBEJVDYHBFCY-IBGZPJMESA-O |
| XLogP | 0.87 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|