C22H23ClN3O6S+ — CID 2091980
(3R)-1-(3-chlorophenyl)-3-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-ium-1-yl]pyrrolidine-2,5-dione (PubChem CID 2091980) has the molecular formula C22H23ClN3O6S+ and a molecular weight of 492.96 g/mol. Its IUPAC name is (3R)-1-(3-chlorophenyl)-3-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-ium-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(3-chlorophenyl)-3-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-ium-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2091980 |
| Molecular Formula | C22H23ClN3O6S+ |
| Molecular Weight | 492.96 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | (3R)-1-(3-chlorophenyl)-3-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-ium-1-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H]([NH+]2CCN(S(=O)(=O)c3ccc4c(c3)OCCO4)CC2)C(=O)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H22ClN3O6S/c23-15-2-1-3-16(12-15)26-21(27)14-18(22(26)28)24-6-8-25(9-7-24)33(29,30)17-4-5-19-20(13-17)32-11-10-31-19/h1-5,12-13,18H,6-11,14H2/p+1/t18-/m1/s1 |
| InChIKey | QOHVVPXPWAUCTO-GOSISDBHSA-O |
| XLogP | 0.33 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.96 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|