C14H16ClN2O3+ — CID 6944442
(3S)-1-(3-chlorophenyl)-3-morpholin-4-ium-4-ylpyrrolidine-2,5-dione (PubChem CID 6944442) has the molecular formula C14H16ClN2O3+ and a molecular weight of 295.75 g/mol. Its IUPAC name is (3S)-1-(3-chlorophenyl)-3-morpholin-4-ium-4-ylpyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(3-chlorophenyl)-3-morpholin-4-ium-4-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 6944442 |
| Molecular Formula | C14H16ClN2O3+ |
| Molecular Weight | 295.75 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | (3S)-1-(3-chlorophenyl)-3-morpholin-4-ium-4-ylpyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H]([NH+]2CCOCC2)C(=O)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H15ClN2O3/c15-10-2-1-3-11(8-10)17-13(18)9-12(14(17)19)16-4-6-20-7-5-16/h1-3,8,12H,4-7,9H2/p+1/t12-/m0/s1 |
| InChIKey | MTSSENIRHIPGNK-LBPRGKRZSA-O |
| XLogP | -0.11 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.75 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|