C25H26N3O4S+ — CID 2091778
(3S)-1-(4-methylphenyl)-3-(4-naphthalen-2-ylsulfonylpiperazin-1-ium-1-yl)pyrrolidine-2,5-dione (PubChem CID 2091778) has the molecular formula C25H26N3O4S+ and a molecular weight of 464.57 g/mol. Its IUPAC name is (3S)-1-(4-methylphenyl)-3-(4-naphthalen-2-ylsulfonylpiperazin-1-ium-1-yl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(4-methylphenyl)-3-(4-naphthalen-2-ylsulfonylpiperazin-1-ium-1-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2091778 |
| Molecular Formula | C25H26N3O4S+ |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | (3S)-1-(4-methylphenyl)-3-(4-naphthalen-2-ylsulfonylpiperazin-1-ium-1-yl)pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)C[C@H]([NH+]3CCN(S(=O)(=O)c4ccc5ccccc5c4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C25H25N3O4S/c1-18-6-9-21(10-7-18)28-24(29)17-23(25(28)30)26-12-14-27(15-13-26)33(31,32)22-11-8-19-4-2-3-5-20(19)16-22/h2-11,16,23H,12-15,17H2,1H3/p+1/t23-/m0/s1 |
| InChIKey | MBGOMLOMCBJMBK-QHCPKHFHSA-O |
| XLogP | 1.37 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|