C20H26N2O6S — CID 5000474
1-(2,4-dimethoxyphenyl)-4-(3,4-dimethoxyphenyl)sulfonylpiperazine (PubChem CID 5000474) has the molecular formula C20H26N2O6S and a molecular weight of 422.50 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-4-(3,4-dimethoxyphenyl)sulfonylpiperazine.
| Compound Name | 1-(2,4-dimethoxyphenyl)-4-(3,4-dimethoxyphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 5000474 |
| Molecular Formula | C20H26N2O6S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-4-(3,4-dimethoxyphenyl)sulfonylpiperazine |
| SMILES | COc1ccc(N2CCN(S(=O)(=O)c3ccc(OC)c(OC)c3)CC2)c(OC)c1 |
| InChI | InChI=1S/C20H26N2O6S/c1-25-15-5-7-17(19(13-15)27-3)21-9-11-22(12-10-21)29(23,24)16-6-8-18(26-2)20(14-16)28-4/h5-8,13-14H,9-12H2,1-4H3 |
| InChIKey | GWKXLQDWWMYLDE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|