C23H26F3N3O5S — CID 3295046
1-[7-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]sulfonyl-3,4-dihydro-1H-isoquinolin-2-yl]-2,2,2-trifluoroethanone (PubChem CID 3295046) has the molecular formula C23H26F3N3O5S and a molecular weight of 513.54 g/mol. Its IUPAC name is 1-[7-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]sulfonyl-3,4-dihydro-1H-isoquinolin-2-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[7-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]sulfonyl-3,4-dihydro-1H-isoquinolin-2-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 3295046 |
| Molecular Formula | C23H26F3N3O5S |
| Molecular Weight | 513.54 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | 1-[7-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]sulfonyl-3,4-dihydro-1H-isoquinolin-2-yl]-2,2,2-trifluoroethanone |
| SMILES | COc1ccc(N2CCN(S(=O)(=O)c3ccc4c(c3)CN(C(=O)C(F)(F)F)CC4)CC2)c(OC)c1 |
| InChI | InChI=1S/C23H26F3N3O5S/c1-33-18-4-6-20(21(14-18)34-2)27-9-11-29(12-10-27)35(31,32)19-5-3-16-7-8-28(15-17(16)13-19)22(30)23(24,25)26/h3-6,13-14H,7-12,15H2,1-2H3 |
| InChIKey | CGJYSTNVIGPARA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.54 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|