C25H29F4N3O6S — CID 46088745
1-[4-[5-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-2-methoxyphenyl]piperazin-1-yl]-2,2,3,3-tetrafluoropropan-1-one (PubChem CID 46088745) has the molecular formula C25H29F4N3O6S and a molecular weight of 575.58 g/mol. Its IUPAC name is 1-[4-[5-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-2-methoxyphenyl]piperazin-1-yl]-2,2,3,3-tetrafluoropropan-1-one.
| Compound Name | 1-[4-[5-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-2-methoxyphenyl]piperazin-1-yl]-2,2,3,3-tetrafluoropropan-1-one |
|---|---|
| PubChem CID | 46088745 |
| Molecular Formula | C25H29F4N3O6S |
| Molecular Weight | 575.58 g/mol |
| Exact Mass | 575.17 |
| IUPAC Name | 1-[4-[5-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-2-methoxyphenyl]piperazin-1-yl]-2,2,3,3-tetrafluoropropan-1-one |
| SMILES | COc1cc2c(cc1OC)CN(S(=O)(=O)c1ccc(OC)c(N3CCN(C(=O)C(F)(F)C(F)F)CC3)c1)CC2 |
| InChI | InChI=1S/C25H29F4N3O6S/c1-36-20-5-4-18(14-19(20)30-8-10-31(11-9-30)24(33)25(28,29)23(26)27)39(34,35)32-7-6-16-12-21(37-2)22(38-3)13-17(16)15-32/h4-5,12-14,23H,6-11,15H2,1-3H3 |
| InChIKey | ZYDBNWJWBABSHM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.58 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|