C27H30N4O9S — CID 46088688
[4-[5-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-2-methoxyphenyl]piperazin-1-yl]-(5-nitrofuran-2-yl)methanone (PubChem CID 46088688) has the molecular formula C27H30N4O9S and a molecular weight of 586.62 g/mol. Its IUPAC name is [4-[5-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-2-methoxyphenyl]piperazin-1-yl]-(5-nitrofuran-2-yl)methanone.
| Compound Name | [4-[5-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-2-methoxyphenyl]piperazin-1-yl]-(5-nitrofuran-2-yl)methanone |
|---|---|
| PubChem CID | 46088688 |
| Molecular Formula | C27H30N4O9S |
| Molecular Weight | 586.62 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | [4-[5-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-2-methoxyphenyl]piperazin-1-yl]-(5-nitrofuran-2-yl)methanone |
| SMILES | COc1cc2c(cc1OC)CN(S(=O)(=O)c1ccc(OC)c(N3CCN(C(=O)c4ccc([N+](=O)[O-])o4)CC3)c1)CC2 |
| InChI | InChI=1S/C27H30N4O9S/c1-37-22-5-4-20(41(35,36)30-9-8-18-14-24(38-2)25(39-3)15-19(18)17-30)16-21(22)28-10-12-29(13-11-28)27(32)23-6-7-26(40-23)31(33)34/h4-7,14-16H,8-13,17H2,1-3H3 |
| InChIKey | WVKMMJCGOHLQCM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 144.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.62 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|