C19H24N2O7S2 — CID 19684107
1-(2,4-dimethoxyphenyl)sulfonyl-4-(4-methoxyphenyl)sulfonylpiperazine (PubChem CID 19684107) has the molecular formula C19H24N2O7S2 and a molecular weight of 456.54 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)sulfonyl-4-(4-methoxyphenyl)sulfonylpiperazine.
| Compound Name | 1-(2,4-dimethoxyphenyl)sulfonyl-4-(4-methoxyphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 19684107 |
| Molecular Formula | C19H24N2O7S2 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)sulfonyl-4-(4-methoxyphenyl)sulfonylpiperazine |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(S(=O)(=O)c3ccc(OC)cc3OC)CC2)cc1 |
| InChI | InChI=1S/C19H24N2O7S2/c1-26-15-4-7-17(8-5-15)29(22,23)20-10-12-21(13-11-20)30(24,25)19-9-6-16(27-2)14-18(19)28-3/h4-9,14H,10-13H2,1-3H3 |
| InChIKey | ACEJAJCAQGFMID-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |