C14H22N2O4S — CID 43605335
[1-(2,4-dimethoxyphenyl)sulfonylpiperidin-4-yl]methanamine (PubChem CID 43605335) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is [1-(2,4-dimethoxyphenyl)sulfonylpiperidin-4-yl]methanamine.
| Compound Name | [1-(2,4-dimethoxyphenyl)sulfonylpiperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 43605335 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | [1-(2,4-dimethoxyphenyl)sulfonylpiperidin-4-yl]methanamine |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(CN)CC2)c(OC)c1 |
| InChI | InChI=1S/C14H22N2O4S/c1-19-12-3-4-14(13(9-12)20-2)21(17,18)16-7-5-11(10-15)6-8-16/h3-4,9,11H,5-8,10,15H2,1-2H3 |
| InChIKey | YBBZEGCTAYIATP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |