C12H19ClN2O3S — CID 119972182
[1-(2-methoxyphenyl)sulfonylpyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 119972182) has the molecular formula C12H19ClN2O3S and a molecular weight of 306.81 g/mol. Its IUPAC name is [1-(2-methoxyphenyl)sulfonylpyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | [1-(2-methoxyphenyl)sulfonylpyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119972182 |
| Molecular Formula | C12H19ClN2O3S |
| Molecular Weight | 306.81 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | [1-(2-methoxyphenyl)sulfonylpyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | COc1ccccc1S(=O)(=O)N1CCC(CN)C1.Cl |
| InChI | InChI=1S/C12H18N2O3S.ClH/c1-17-11-4-2-3-5-12(11)18(15,16)14-7-6-10(8-13)9-14;/h2-5,10H,6-9,13H2,1H3;1H |
| InChIKey | HXWPNDVJAILWDW-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.81 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |