C11H16Cl2N2O2S — CID 119972183
[1-(2-chlorophenyl)sulfonylpyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 119972183) has the molecular formula C11H16Cl2N2O2S and a molecular weight of 311.23 g/mol. Its IUPAC name is [1-(2-chlorophenyl)sulfonylpyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | [1-(2-chlorophenyl)sulfonylpyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119972183 |
| Molecular Formula | C11H16Cl2N2O2S |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | [1-(2-chlorophenyl)sulfonylpyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | Cl.NCC1CCN(S(=O)(=O)c2ccccc2Cl)C1 |
| InChI | InChI=1S/C11H15ClN2O2S.ClH/c12-10-3-1-2-4-11(10)17(15,16)14-6-5-9(7-13)8-14;/h1-4,9H,5-8,13H2;1H |
| InChIKey | LATMYHDIIKWVPZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |