C11H15Cl2FN2O2S — CID 119972159
[1-(2-chloro-5-fluorophenyl)sulfonylpyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 119972159) has the molecular formula C11H15Cl2FN2O2S and a molecular weight of 329.22 g/mol. Its IUPAC name is [1-(2-chloro-5-fluorophenyl)sulfonylpyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | [1-(2-chloro-5-fluorophenyl)sulfonylpyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119972159 |
| Molecular Formula | C11H15Cl2FN2O2S |
| Molecular Weight | 329.22 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | [1-(2-chloro-5-fluorophenyl)sulfonylpyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | Cl.NCC1CCN(S(=O)(=O)c2cc(F)ccc2Cl)C1 |
| InChI | InChI=1S/C11H14ClFN2O2S.ClH/c12-10-2-1-9(13)5-11(10)18(16,17)15-4-3-8(6-14)7-15;/h1-2,5,8H,3-4,6-7,14H2;1H |
| InChIKey | MTUGAALFBNRCRM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.22 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |