C13H16Cl2FNO2S — CID 105400625
3-(2-chloroethyl)-1-(2-chloro-5-fluorophenyl)sulfonylpiperidine (PubChem CID 105400625) has the molecular formula C13H16Cl2FNO2S and a molecular weight of 340.25 g/mol. Its IUPAC name is 3-(2-chloroethyl)-1-(2-chloro-5-fluorophenyl)sulfonylpiperidine.
| Compound Name | 3-(2-chloroethyl)-1-(2-chloro-5-fluorophenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 105400625 |
| Molecular Formula | C13H16Cl2FNO2S |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 3-(2-chloroethyl)-1-(2-chloro-5-fluorophenyl)sulfonylpiperidine |
| SMILES | O=S(=O)(c1cc(F)ccc1Cl)N1CCCC(CCCl)C1 |
| InChI | InChI=1S/C13H16Cl2FNO2S/c14-6-5-10-2-1-7-17(9-10)20(18,19)13-8-11(16)3-4-12(13)15/h3-4,8,10H,1-2,5-7,9H2 |
| InChIKey | VXIIKDNTKCFJAP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|