C13H19Cl2FN2O2S — CID 120894317
2-[1-(5-chloro-2-fluorophenyl)sulfonylpiperidin-3-yl]ethanamine;hydrochloride (PubChem CID 120894317) has the molecular formula C13H19Cl2FN2O2S and a molecular weight of 357.28 g/mol. Its IUPAC name is 2-[1-(5-chloro-2-fluorophenyl)sulfonylpiperidin-3-yl]ethanamine;hydrochloride.
| Compound Name | 2-[1-(5-chloro-2-fluorophenyl)sulfonylpiperidin-3-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 120894317 |
| Molecular Formula | C13H19Cl2FN2O2S |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 2-[1-(5-chloro-2-fluorophenyl)sulfonylpiperidin-3-yl]ethanamine;hydrochloride |
| SMILES | Cl.NCCC1CCCN(S(=O)(=O)c2cc(Cl)ccc2F)C1 |
| InChI | InChI=1S/C13H18ClFN2O2S.ClH/c14-11-3-4-12(15)13(8-11)20(18,19)17-7-1-2-10(9-17)5-6-16;/h3-4,8,10H,1-2,5-7,9,16H2;1H |
| InChIKey | YUQDOUMVRJMYAG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |