C12H16ClFN2O2S — CID 119971913
[1-(2-chloro-4-fluoro-5-methylphenyl)sulfonylpyrrolidin-3-yl]methanamine (PubChem CID 119971913) has the molecular formula C12H16ClFN2O2S and a molecular weight of 306.79 g/mol. Its IUPAC name is [1-(2-chloro-4-fluoro-5-methylphenyl)sulfonylpyrrolidin-3-yl]methanamine.
| Compound Name | [1-(2-chloro-4-fluoro-5-methylphenyl)sulfonylpyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 119971913 |
| Molecular Formula | C12H16ClFN2O2S |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | [1-(2-chloro-4-fluoro-5-methylphenyl)sulfonylpyrrolidin-3-yl]methanamine |
| SMILES | Cc1cc(S(=O)(=O)N2CCC(CN)C2)c(Cl)cc1F |
| InChI | InChI=1S/C12H16ClFN2O2S/c1-8-4-12(10(13)5-11(8)14)19(17,18)16-3-2-9(6-15)7-16/h4-5,9H,2-3,6-7,15H2,1H3 |
| InChIKey | GMSCUTSHVXPNKK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |