C15H20ClFN2O4S — CID 120726940
2-[[1-(2-chloro-4-fluoro-5-methylphenyl)sulfonylpiperidin-3-yl]methylamino]acetic acid (PubChem CID 120726940) has the molecular formula C15H20ClFN2O4S and a molecular weight of 378.85 g/mol. Its IUPAC name is 2-[[1-(2-chloro-4-fluoro-5-methylphenyl)sulfonylpiperidin-3-yl]methylamino]acetic acid.
| Compound Name | 2-[[1-(2-chloro-4-fluoro-5-methylphenyl)sulfonylpiperidin-3-yl]methylamino]acetic acid |
|---|---|
| PubChem CID | 120726940 |
| Molecular Formula | C15H20ClFN2O4S |
| Molecular Weight | 378.85 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 2-[[1-(2-chloro-4-fluoro-5-methylphenyl)sulfonylpiperidin-3-yl]methylamino]acetic acid |
| SMILES | Cc1cc(S(=O)(=O)N2CCCC(CNCC(=O)O)C2)c(Cl)cc1F |
| InChI | InChI=1S/C15H20ClFN2O4S/c1-10-5-14(12(16)6-13(10)17)24(22,23)19-4-2-3-11(9-19)7-18-8-15(20)21/h5-6,11,18H,2-4,7-9H2,1H3,(H,20,21) |
| InChIKey | DAECWGOVODRXIU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.85 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |