C15H23ClN2O4S — CID 120727081
2-[[1-(2-methylphenyl)sulfonylpiperidin-3-yl]methylamino]acetic acid;hydrochloride (PubChem CID 120727081) has the molecular formula C15H23ClN2O4S and a molecular weight of 362.88 g/mol. Its IUPAC name is 2-[[1-(2-methylphenyl)sulfonylpiperidin-3-yl]methylamino]acetic acid;hydrochloride.
| Compound Name | 2-[[1-(2-methylphenyl)sulfonylpiperidin-3-yl]methylamino]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 120727081 |
| Molecular Formula | C15H23ClN2O4S |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 2-[[1-(2-methylphenyl)sulfonylpiperidin-3-yl]methylamino]acetic acid;hydrochloride |
| SMILES | Cc1ccccc1S(=O)(=O)N1CCCC(CNCC(=O)O)C1.Cl |
| InChI | InChI=1S/C15H22N2O4S.ClH/c1-12-5-2-3-7-14(12)22(20,21)17-8-4-6-13(11-17)9-16-10-15(18)19;/h2-3,5,7,13,16H,4,6,8-11H2,1H3,(H,18,19);1H |
| InChIKey | DOHXNUGIFQVHOW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |