C20H25ClN2O3S — CID 120999042
[2-[3-(methylaminomethyl)piperidin-1-yl]sulfonylphenyl]-phenylmethanone;hydrochloride (PubChem CID 120999042) has the molecular formula C20H25ClN2O3S and a molecular weight of 408.95 g/mol. Its IUPAC name is [2-[3-(methylaminomethyl)piperidin-1-yl]sulfonylphenyl]-phenylmethanone;hydrochloride.
| Compound Name | [2-[3-(methylaminomethyl)piperidin-1-yl]sulfonylphenyl]-phenylmethanone;hydrochloride |
|---|---|
| PubChem CID | 120999042 |
| Molecular Formula | C20H25ClN2O3S |
| Molecular Weight | 408.95 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | [2-[3-(methylaminomethyl)piperidin-1-yl]sulfonylphenyl]-phenylmethanone;hydrochloride |
| SMILES | CNCC1CCCN(S(=O)(=O)c2ccccc2C(=O)c2ccccc2)C1.Cl |
| InChI | InChI=1S/C20H24N2O3S.ClH/c1-21-14-16-8-7-13-22(15-16)26(24,25)19-12-6-5-11-18(19)20(23)17-9-3-2-4-10-17;/h2-6,9-12,16,21H,7-8,13-15H2,1H3;1H |
| InChIKey | QFHYSTBGYLSXMZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.95 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |