C19H25ClN2O2S — CID 120998970
N-methyl-1-[1-(3-phenylphenyl)sulfonylpiperidin-3-yl]methanamine;hydrochloride (PubChem CID 120998970) has the molecular formula C19H25ClN2O2S and a molecular weight of 380.94 g/mol. Its IUPAC name is N-methyl-1-[1-(3-phenylphenyl)sulfonylpiperidin-3-yl]methanamine;hydrochloride.
| Compound Name | N-methyl-1-[1-(3-phenylphenyl)sulfonylpiperidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120998970 |
| Molecular Formula | C19H25ClN2O2S |
| Molecular Weight | 380.94 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N-methyl-1-[1-(3-phenylphenyl)sulfonylpiperidin-3-yl]methanamine;hydrochloride |
| SMILES | CNCC1CCCN(S(=O)(=O)c2cccc(-c3ccccc3)c2)C1.Cl |
| InChI | InChI=1S/C19H24N2O2S.ClH/c1-20-14-16-7-6-12-21(15-16)24(22,23)19-11-5-10-18(13-19)17-8-3-2-4-9-17;/h2-5,8-11,13,16,20H,6-7,12,14-15H2,1H3;1H |
| InChIKey | NDXSVUDZJUIUEJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.94 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |