C15H25ClN2O4S2 — CID 119961100
1-[1-(3-ethylsulfonylphenyl)sulfonylpiperidin-3-yl]-N-methylmethanamine;hydrochloride (PubChem CID 119961100) has the molecular formula C15H25ClN2O4S2 and a molecular weight of 396.96 g/mol. Its IUPAC name is 1-[1-(3-ethylsulfonylphenyl)sulfonylpiperidin-3-yl]-N-methylmethanamine;hydrochloride.
| Compound Name | 1-[1-(3-ethylsulfonylphenyl)sulfonylpiperidin-3-yl]-N-methylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 119961100 |
| Molecular Formula | C15H25ClN2O4S2 |
| Molecular Weight | 396.96 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 1-[1-(3-ethylsulfonylphenyl)sulfonylpiperidin-3-yl]-N-methylmethanamine;hydrochloride |
| SMILES | CCS(=O)(=O)c1cccc(S(=O)(=O)N2CCCC(CNC)C2)c1.Cl |
| InChI | InChI=1S/C15H24N2O4S2.ClH/c1-3-22(18,19)14-7-4-8-15(10-14)23(20,21)17-9-5-6-13(12-17)11-16-2;/h4,7-8,10,13,16H,3,5-6,9,11-12H2,1-2H3;1H |
| InChIKey | QNZIWMMPCXOCQD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.96 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |