C15H25ClN2O2S — CID 119961401
1-[1-(3-ethylphenyl)sulfonylpiperidin-3-yl]-N-methylmethanamine;hydrochloride (PubChem CID 119961401) has the molecular formula C15H25ClN2O2S and a molecular weight of 332.90 g/mol. Its IUPAC name is 1-[1-(3-ethylphenyl)sulfonylpiperidin-3-yl]-N-methylmethanamine;hydrochloride.
| Compound Name | 1-[1-(3-ethylphenyl)sulfonylpiperidin-3-yl]-N-methylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 119961401 |
| Molecular Formula | C15H25ClN2O2S |
| Molecular Weight | 332.90 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1-[1-(3-ethylphenyl)sulfonylpiperidin-3-yl]-N-methylmethanamine;hydrochloride |
| SMILES | CCc1cccc(S(=O)(=O)N2CCCC(CNC)C2)c1.Cl |
| InChI | InChI=1S/C15H24N2O2S.ClH/c1-3-13-6-4-8-15(10-13)20(18,19)17-9-5-7-14(12-17)11-16-2;/h4,6,8,10,14,16H,3,5,7,9,11-12H2,1-2H3;1H |
| InChIKey | ZRRXJDOMUYINJS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.90 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |