C13H20ClIN2O2S — CID 119961461
1-[1-(3-iodophenyl)sulfonylpiperidin-3-yl]-N-methylmethanamine;hydrochloride (PubChem CID 119961461) has the molecular formula C13H20ClIN2O2S and a molecular weight of 430.74 g/mol. Its IUPAC name is 1-[1-(3-iodophenyl)sulfonylpiperidin-3-yl]-N-methylmethanamine;hydrochloride.
| Compound Name | 1-[1-(3-iodophenyl)sulfonylpiperidin-3-yl]-N-methylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 119961461 |
| Molecular Formula | C13H20ClIN2O2S |
| Molecular Weight | 430.74 g/mol |
| Exact Mass | 430.00 |
| IUPAC Name | 1-[1-(3-iodophenyl)sulfonylpiperidin-3-yl]-N-methylmethanamine;hydrochloride |
| SMILES | CNCC1CCCN(S(=O)(=O)c2cccc(I)c2)C1.Cl |
| InChI | InChI=1S/C13H19IN2O2S.ClH/c1-15-9-11-4-3-7-16(10-11)19(17,18)13-6-2-5-12(14)8-13;/h2,5-6,8,11,15H,3-4,7,9-10H2,1H3;1H |
| InChIKey | CPHIBYDRSZYWIJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.74 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|