C14H20ClFN2O2S — CID 119978143
1-[1-(2-chloro-4-fluoro-5-methylphenyl)sulfonylpiperidin-4-yl]-N-methylmethanamine (PubChem CID 119978143) has the molecular formula C14H20ClFN2O2S and a molecular weight of 334.84 g/mol. Its IUPAC name is 1-[1-(2-chloro-4-fluoro-5-methylphenyl)sulfonylpiperidin-4-yl]-N-methylmethanamine.
| Compound Name | 1-[1-(2-chloro-4-fluoro-5-methylphenyl)sulfonylpiperidin-4-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 119978143 |
| Molecular Formula | C14H20ClFN2O2S |
| Molecular Weight | 334.84 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 1-[1-(2-chloro-4-fluoro-5-methylphenyl)sulfonylpiperidin-4-yl]-N-methylmethanamine |
| SMILES | CNCC1CCN(S(=O)(=O)c2cc(C)c(F)cc2Cl)CC1 |
| InChI | InChI=1S/C14H20ClFN2O2S/c1-10-7-14(12(15)8-13(10)16)21(19,20)18-5-3-11(4-6-18)9-17-2/h7-8,11,17H,3-6,9H2,1-2H3 |
| InChIKey | OFUUFUWVGUXGAV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.84 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |