C13H19BrN2O2S — CID 119971817
[1-(4-bromo-2,5-dimethylphenyl)sulfonylpyrrolidin-3-yl]methanamine (PubChem CID 119971817) has the molecular formula C13H19BrN2O2S and a molecular weight of 347.28 g/mol. Its IUPAC name is [1-(4-bromo-2,5-dimethylphenyl)sulfonylpyrrolidin-3-yl]methanamine.
| Compound Name | [1-(4-bromo-2,5-dimethylphenyl)sulfonylpyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 119971817 |
| Molecular Formula | C13H19BrN2O2S |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | [1-(4-bromo-2,5-dimethylphenyl)sulfonylpyrrolidin-3-yl]methanamine |
| SMILES | Cc1cc(S(=O)(=O)N2CCC(CN)C2)c(C)cc1Br |
| InChI | InChI=1S/C13H19BrN2O2S/c1-9-6-13(10(2)5-12(9)14)19(17,18)16-4-3-11(7-15)8-16/h5-6,11H,3-4,7-8,15H2,1-2H3 |
| InChIKey | OZXTUGASXVQDKY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |