C14H21BrN2O2S — CID 114626275
2-bromo-5-(3,4-dimethylpiperidin-1-yl)sulfonyl-4-methylaniline (PubChem CID 114626275) has the molecular formula C14H21BrN2O2S and a molecular weight of 361.31 g/mol. Its IUPAC name is 2-bromo-5-(3,4-dimethylpiperidin-1-yl)sulfonyl-4-methylaniline.
| Compound Name | 2-bromo-5-(3,4-dimethylpiperidin-1-yl)sulfonyl-4-methylaniline |
|---|---|
| PubChem CID | 114626275 |
| Molecular Formula | C14H21BrN2O2S |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 2-bromo-5-(3,4-dimethylpiperidin-1-yl)sulfonyl-4-methylaniline |
| SMILES | Cc1cc(Br)c(N)cc1S(=O)(=O)N1CCC(C)C(C)C1 |
| InChI | InChI=1S/C14H21BrN2O2S/c1-9-4-5-17(8-11(9)3)20(18,19)14-7-13(16)12(15)6-10(14)2/h6-7,9,11H,4-5,8,16H2,1-3H3 |
| InChIKey | NXQCGNRVBIFPIY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|