C11H15BrN2O4S — CID 107212054
(3R)-1-(5-amino-4-bromo-2-methoxyphenyl)sulfonylpyrrolidin-3-ol (PubChem CID 107212054) has the molecular formula C11H15BrN2O4S and a molecular weight of 351.22 g/mol. Its IUPAC name is (3R)-1-(5-amino-4-bromo-2-methoxyphenyl)sulfonylpyrrolidin-3-ol.
| Compound Name | (3R)-1-(5-amino-4-bromo-2-methoxyphenyl)sulfonylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 107212054 |
| Molecular Formula | C11H15BrN2O4S |
| Molecular Weight | 351.22 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | (3R)-1-(5-amino-4-bromo-2-methoxyphenyl)sulfonylpyrrolidin-3-ol |
| SMILES | COc1cc(Br)c(N)cc1S(=O)(=O)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C11H15BrN2O4S/c1-18-10-4-8(12)9(13)5-11(10)19(16,17)14-3-2-7(15)6-14/h4-5,7,15H,2-3,6,13H2,1H3/t7-/m1/s1 |
| InChIKey | SDEWOHLPIZWJPI-SSDOTTSWSA-N |
| XLogP | 0.80 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.22 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|