C11H15BrN2O3S — CID 107212055
(3R)-1-(5-amino-4-bromo-2-methylphenyl)sulfonylpyrrolidin-3-ol (PubChem CID 107212055) has the molecular formula C11H15BrN2O3S and a molecular weight of 335.22 g/mol. Its IUPAC name is (3R)-1-(5-amino-4-bromo-2-methylphenyl)sulfonylpyrrolidin-3-ol.
| Compound Name | (3R)-1-(5-amino-4-bromo-2-methylphenyl)sulfonylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 107212055 |
| Molecular Formula | C11H15BrN2O3S |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | (3R)-1-(5-amino-4-bromo-2-methylphenyl)sulfonylpyrrolidin-3-ol |
| SMILES | Cc1cc(Br)c(N)cc1S(=O)(=O)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C11H15BrN2O3S/c1-7-4-9(12)10(13)5-11(7)18(16,17)14-3-2-8(15)6-14/h4-5,8,15H,2-3,6,13H2,1H3/t8-/m1/s1 |
| InChIKey | XDRWPAWVOIPZMS-MRVPVSSYSA-N |
| XLogP | 1.10 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|