C14H22BrN3O2S — CID 114625187
2-bromo-4-methyl-5-(4-propan-2-ylpiperazin-1-yl)sulfonylaniline (PubChem CID 114625187) has the molecular formula C14H22BrN3O2S and a molecular weight of 376.32 g/mol. Its IUPAC name is 2-bromo-4-methyl-5-(4-propan-2-ylpiperazin-1-yl)sulfonylaniline.
| Compound Name | 2-bromo-4-methyl-5-(4-propan-2-ylpiperazin-1-yl)sulfonylaniline |
|---|---|
| PubChem CID | 114625187 |
| Molecular Formula | C14H22BrN3O2S |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 2-bromo-4-methyl-5-(4-propan-2-ylpiperazin-1-yl)sulfonylaniline |
| SMILES | Cc1cc(Br)c(N)cc1S(=O)(=O)N1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C14H22BrN3O2S/c1-10(2)17-4-6-18(7-5-17)21(19,20)14-9-13(16)12(15)8-11(14)3/h8-10H,4-7,16H2,1-3H3 |
| InChIKey | ALQVUEYFWRSPJC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|