C18H29N3O5S — CID 113073742
4-[2-[4-(2,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]ethyl]morpholine (PubChem CID 113073742) has the molecular formula C18H29N3O5S and a molecular weight of 399.51 g/mol. Its IUPAC name is 4-[2-[4-(2,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]ethyl]morpholine.
| Compound Name | 4-[2-[4-(2,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]ethyl]morpholine |
|---|---|
| PubChem CID | 113073742 |
| Molecular Formula | C18H29N3O5S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 4-[2-[4-(2,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]ethyl]morpholine |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(CCN3CCOCC3)CC2)c(OC)c1 |
| InChI | InChI=1S/C18H29N3O5S/c1-24-16-3-4-18(17(15-16)25-2)27(22,23)21-9-7-19(8-10-21)5-6-20-11-13-26-14-12-20/h3-4,15H,5-14H2,1-2H3 |
| InChIKey | UJBXCRNKGVZHAW-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |