C14H22N2O6S — CID 110642838
2,5-dimethoxy-N-(2-morpholin-4-ylethoxy)benzenesulfonamide (PubChem CID 110642838) has the molecular formula C14H22N2O6S and a molecular weight of 346.41 g/mol. Its IUPAC name is 2,5-dimethoxy-N-(2-morpholin-4-ylethoxy)benzenesulfonamide.
| Compound Name | 2,5-dimethoxy-N-(2-morpholin-4-ylethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 110642838 |
| Molecular Formula | C14H22N2O6S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 2,5-dimethoxy-N-(2-morpholin-4-ylethoxy)benzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NOCCN2CCOCC2)c1 |
| InChI | InChI=1S/C14H22N2O6S/c1-19-12-3-4-13(20-2)14(11-12)23(17,18)15-22-10-7-16-5-8-21-9-6-16/h3-4,11,15H,5-10H2,1-2H3 |
| InChIKey | TWHYTXUCKGIUIF-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|