C15H19NO6S — CID 110315822
N-[3-(furan-2-yl)propoxy]-2,5-dimethoxybenzenesulfonamide (PubChem CID 110315822) has the molecular formula C15H19NO6S and a molecular weight of 341.38 g/mol. Its IUPAC name is N-[3-(furan-2-yl)propoxy]-2,5-dimethoxybenzenesulfonamide.
| Compound Name | N-[3-(furan-2-yl)propoxy]-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 110315822 |
| Molecular Formula | C15H19NO6S |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | N-[3-(furan-2-yl)propoxy]-2,5-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NOCCCc2ccco2)c1 |
| InChI | InChI=1S/C15H19NO6S/c1-19-13-7-8-14(20-2)15(11-13)23(17,18)16-22-10-4-6-12-5-3-9-21-12/h3,5,7-9,11,16H,4,6,10H2,1-2H3 |
| InChIKey | JVTCXRJZAYLYHJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|