C14H17NO6S — CID 110759282
N-(furan-2-ylmethyl)-2,4,6-trimethoxybenzenesulfonamide (PubChem CID 110759282) has the molecular formula C14H17NO6S and a molecular weight of 327.36 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2,4,6-trimethoxybenzenesulfonamide.
| Compound Name | N-(furan-2-ylmethyl)-2,4,6-trimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 110759282 |
| Molecular Formula | C14H17NO6S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | N-(furan-2-ylmethyl)-2,4,6-trimethoxybenzenesulfonamide |
| SMILES | COc1cc(OC)c(S(=O)(=O)NCc2ccco2)c(OC)c1 |
| InChI | InChI=1S/C14H17NO6S/c1-18-11-7-12(19-2)14(13(8-11)20-3)22(16,17)15-9-10-5-4-6-21-10/h4-8,15H,9H2,1-3H3 |
| InChIKey | RKVRNSKDIYAWPM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |