C12H9F4NO4S — CID 18191791
2,3,5,6-tetrafluoro-N-(furan-2-ylmethyl)-4-methoxybenzenesulfonamide (PubChem CID 18191791) has the molecular formula C12H9F4NO4S and a molecular weight of 339.27 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-(furan-2-ylmethyl)-4-methoxybenzenesulfonamide.
| Compound Name | 2,3,5,6-tetrafluoro-N-(furan-2-ylmethyl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 18191791 |
| Molecular Formula | C12H9F4NO4S |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-(furan-2-ylmethyl)-4-methoxybenzenesulfonamide |
| SMILES | COc1c(F)c(F)c(S(=O)(=O)NCc2ccco2)c(F)c1F |
| InChI | InChI=1S/C12H9F4NO4S/c1-20-11-7(13)9(15)12(10(16)8(11)14)22(18,19)17-5-6-3-2-4-21-6/h2-4,17H,5H2,1H3 |
| InChIKey | TXVAHJVIQBTBDX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|