C11H8BrCl2NO3S — CID 26944366
4-bromo-2,6-dichloro-N-(furan-2-ylmethyl)benzenesulfonamide (PubChem CID 26944366) has the molecular formula C11H8BrCl2NO3S and a molecular weight of 385.07 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(furan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-bromo-2,6-dichloro-N-(furan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 26944366 |
| Molecular Formula | C11H8BrCl2NO3S |
| Molecular Weight | 385.07 g/mol |
| Exact Mass | 382.88 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(furan-2-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccco1)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C11H8BrCl2NO3S/c12-7-4-9(13)11(10(14)5-7)19(16,17)15-6-8-2-1-3-18-8/h1-5,15H,6H2 |
| InChIKey | JHEXCQRVLWPIFL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.07 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |