C13H15ClN2O3S — CID 107091317
3-chloro-N-(furan-2-ylmethyl)-4-(methylaminomethyl)benzenesulfonamide (PubChem CID 107091317) has the molecular formula C13H15ClN2O3S and a molecular weight of 314.79 g/mol. Its IUPAC name is 3-chloro-N-(furan-2-ylmethyl)-4-(methylaminomethyl)benzenesulfonamide.
| Compound Name | 3-chloro-N-(furan-2-ylmethyl)-4-(methylaminomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 107091317 |
| Molecular Formula | C13H15ClN2O3S |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 3-chloro-N-(furan-2-ylmethyl)-4-(methylaminomethyl)benzenesulfonamide |
| SMILES | CNCc1ccc(S(=O)(=O)NCc2ccco2)cc1Cl |
| InChI | InChI=1S/C13H15ClN2O3S/c1-15-8-10-4-5-12(7-13(10)14)20(17,18)16-9-11-3-2-6-19-11/h2-7,15-16H,8-9H2,1H3 |
| InChIKey | ONQOYNJHGUZVGE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |