C18H17ClN2O5S2 — CID 55880160
3-chloro-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]-4-methylbenzenesulfonamide (PubChem CID 55880160) has the molecular formula C18H17ClN2O5S2 and a molecular weight of 440.93 g/mol. Its IUPAC name is 3-chloro-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]-4-methylbenzenesulfonamide.
| Compound Name | 3-chloro-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 55880160 |
| Molecular Formula | C18H17ClN2O5S2 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | 3-chloro-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cccc(S(=O)(=O)NCc3ccco3)c2)cc1Cl |
| InChI | InChI=1S/C18H17ClN2O5S2/c1-13-7-8-17(11-18(13)19)28(24,25)21-14-4-2-6-16(10-14)27(22,23)20-12-15-5-3-9-26-15/h2-11,20-21H,12H2,1H3 |
| InChIKey | FEGKEEPRTIIDLA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |