C11H9Cl2NO3S — CID 738690
3,4-dichloro-N-(furan-2-ylmethyl)benzenesulfonamide (PubChem CID 738690) has the molecular formula C11H9Cl2NO3S and a molecular weight of 306.17 g/mol. Its IUPAC name is 3,4-dichloro-N-(furan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-(furan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 738690 |
| Molecular Formula | C11H9Cl2NO3S |
| Molecular Weight | 306.17 g/mol |
| Exact Mass | 304.97 |
| IUPAC Name | 3,4-dichloro-N-(furan-2-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccco1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H9Cl2NO3S/c12-10-4-3-9(6-11(10)13)18(15,16)14-7-8-2-1-5-17-8/h1-6,14H,7H2 |
| InChIKey | IYOHWNPUYJWIKI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.17 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |