C13H12ClFN2O4S — CID 38254473
2-[(3-chloro-4-fluorophenyl)sulfonylamino]-N-(furan-2-ylmethyl)acetamide (PubChem CID 38254473) has the molecular formula C13H12ClFN2O4S and a molecular weight of 346.77 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)sulfonylamino]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)sulfonylamino]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 38254473 |
| Molecular Formula | C13H12ClFN2O4S |
| Molecular Weight | 346.77 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)sulfonylamino]-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc(F)c(Cl)c1)NCc1ccco1 |
| InChI | InChI=1S/C13H12ClFN2O4S/c14-11-6-10(3-4-12(11)15)22(19,20)17-8-13(18)16-7-9-2-1-5-21-9/h1-6,17H,7-8H2,(H,16,18) |
| InChIKey | KSLCNEGGBMLFKR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.77 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |